CAS 51984-61-3

2-Methyl-5-nitro-3-pyridinamine

Description:

2-Methyl-5-nitro-3-pyridinamine, with the CAS number 51984-61-3, is an organic compound belonging to the class of pyridine derivatives. It features a pyridine ring substituted with a methyl group at the 2-position and a nitro group at the 5-position, along with an amino group at the 3-position. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the nitro group introduces significant polarity and can influence the compound's solubility in various solvents, typically making it more soluble in polar solvents. The amino group can participate in hydrogen bonding, enhancing its reactivity in various chemical reactions, such as nucleophilic substitutions. 2-Methyl-5-nitro-3-pyridinamine may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, including melting point, boiling point, and specific reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound is a valuable subject for further investigation in both synthetic and medicinal chemistry.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c1-4-6(7)2-5(3-8-4)9(10)11/h2-3H,7H2,1H3

SMILES: Cc1c(cc(cn1)N(=O)=O)N

Synonyms:

• 2-Methyl-5-Nitropyridin-3-Amine

2-Methyl-5-nitropyridin-3-amine

CAS: 51984-61-3

Formula: C₆H₇N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.1387

Ref: IN-DA00D8EV

2-Methyl-5-nitropyridin-3-amine

CAS: 51984-61-3

2-Methyl-5-nitropyridin-3-amine

Purity: 97%

Molecular weight: 153.14g/mol

Ref: 54-OR91690

2-Methyl-5-nitropyridin-3-amine

CAS: 51984-61-3

Formula: C₆H₇N₃O₂

Purity: 97%

Molecular weight: 153.141

Ref: 10-F224085

2-Methyl-5-nitropyridin-3-amine

CAS: 51984-61-3

2-Methyl-5-nitropyridin-3-amine is a heterocyclic compound that is synthesized by the cyclization of 2-methylpyridine with sodium nitrite. The reaction product is hydrolyzed to yield the desired compound, 5-nitropyridine. The synthesis of this compound can be used as a target for organic synthesis.

Formula: C₆H₇N₃O₂

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-FM140823