CymitQuimica logo

CAS 51985-95-6

:

methyl 1-methyl-5-oxo-2,5-dihydro-1H-pyrazole-3-carboxylate

Description:
Methyl 1-methyl-5-oxo-2,5-dihydro-1H-pyrazole-3-carboxylate, with the CAS number 51985-95-6, is a chemical compound that belongs to the class of pyrazole derivatives. This substance typically exhibits a molecular structure characterized by a pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a carboxylate group contributes to its acidic properties, while the methyl groups enhance its lipophilicity, potentially influencing its solubility in organic solvents. The compound is often studied for its potential biological activities, including anti-inflammatory and analgesic properties, making it of interest in medicinal chemistry. Additionally, its reactivity can be attributed to the carbonyl and carboxylate functionalities, which may participate in various chemical reactions, such as esterification or nucleophilic attacks. Overall, methyl 1-methyl-5-oxo-2,5-dihydro-1H-pyrazole-3-carboxylate is a versatile compound with applications in both research and potential therapeutic contexts.
Formula:C6H8N2O3
InChI:InChI=1/C6H8N2O3/c1-8-5(9)3-4(7-8)6(10)11-2/h3,7H,1-2H3
InChI key:LWNUKBMQSHAGKD-UHFFFAOYSA-N
SMILES:Cn1c(=O)cc(C(=O)OC)[nH]1
Synonyms:
  • 5-Hydroxy-1-Methyl-1H-Pyrazole-3-Carboxylic Acid Methyl Ester
Found 4 products.