CymitQuimica logo

CAS 51986-17-5

:

Ethyl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate, with the CAS number 51986-17-5, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylate group and a hydroxyl group, contributing to its potential as a versatile building block in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Ethyl 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate may exhibit biological activity, making it of interest in pharmaceutical research. However, specific applications and safety data should be reviewed in the context of its use in laboratory or industrial settings.
Formula:C7H10N2O3
InChI:InChI=1/C7H10N2O3/c1-3-12-7(11)5-4-6(10)9(2)8-5/h4,10H,3H2,1-2H3
InChI key:OMGLOQRFAJAMTB-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc(n(C)n1)O
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-hydroxy-1-methyl-, ethyl ester
Found 4 products.