CAS 520-31-0
:Tricetin
Description:
Tricetin, with the CAS number 520-31-0, is a flavonoid compound belonging to the flavone class. It is characterized by its yellow crystalline appearance and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. Tricetin is known for its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anticancer activities. It is found in various plants, particularly in the leaves and flowers of certain species, and is often studied for its role in traditional medicine and dietary supplements. The compound exhibits a range of biological activities, including the ability to scavenge free radicals and modulate various signaling pathways. Additionally, tricetin has been investigated for its potential effects on cardiovascular health and metabolic disorders. Its structural features include multiple hydroxyl groups, which enhance its reactivity and interaction with biological systems. Overall, tricetin is a compound of interest in both nutritional science and pharmacology due to its diverse biological effects.
Formula:C15H10O7
InChI:InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H
InChI key:InChIKey=ARSRJFRKVXALTF-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(O)=C(O)C(O)=C3)=CC(O)=CC2O
Synonyms:- 4H-1-benzopyran-4-one, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-
- 5,7,3',4',5'-Pentahydroxyflavone
- 5,7,3′,4′,5′-Pentahydroxyflavone
- 5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
- 5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-on
- 520-31-0
- Flavone, 3′,4′,5,5′,7-pentahydroxy-
- Tricetin
- 5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one
- 5,7-Dihydroxy-2-(3,4,5-trihydroxyphényl)-4H-chromén-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tricetin
CAS:Tricetin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H10O7Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:302.24Tricetin
CAS:Tricetin, a flavonoid from pomegranate, hinders Keap1-Nrf2 PPI, protects from Parkinson's & nasopharyngeal carcinoma, and combats inflammation.Formula:C15H10O7Purity:98.79%Color and Shape:SolidMolecular weight:302.245,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one
CAS:Controlled ProductFormula:C15H10O7Color and Shape:BrownMolecular weight:302.24Tricetin
CAS:<p>Tricetin is a naturally occurring flavonoid compound, which is primarily sourced from various plant species. Its molecular structure comprises multiple hydroxyl groups, contributing to its biological activity. Tricetin functions by modulating several biochemical pathways; it exhibits antioxidant properties through scavenging of reactive oxygen species and chelation of metal ions. Additionally, Tricetin possesses anti-inflammatory effects, as it can inhibit the synthesis of pro-inflammatory cytokines and downregulate the expression of enzymes involved in inflammation, such as cyclooxygenase and lipoxygenase.</p>Formula:C15H10O7Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:302.24 g/mol





