CAS 520-63-8
:Heliotridine
Description:
Heliotridine, with the CAS number 520-63-8, is an alkaloid primarily derived from plants in the Heliotropium genus. It is characterized by its bicyclic structure, which includes a pyrrolidine ring fused to a pyridine ring. This compound is known for its potential biological activities, including neurotoxic effects, which have been studied in various contexts. Heliotridine is often associated with the toxicity of certain plants, particularly in relation to livestock poisoning. In terms of physical properties, it is typically a colorless to pale yellow liquid with a distinctive odor. The compound is soluble in organic solvents but has limited solubility in water. Due to its toxicological profile, handling heliotridine requires caution, and it is important to adhere to safety protocols in laboratory settings. Its presence in certain plant species has implications for both ecological studies and agricultural practices, particularly concerning the management of toxic plants.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,7-8,10-11H,2-5H2/t7-,8+/m0/s1
InChI key:InChIKey=HJSJELVDQOXCHO-JGVFFNPUSA-N
SMILES:C(O)C=1[C@]2(N(CC1)CC[C@@H]2O)[H]
Synonyms:- (+)-Heliotridine
- (1S,7aR)-2,3,5,7a-Tetrahydro-1-hydroxy-1H-pyrrolizine-7-methanol
- 1H-Pyrrolizine-7-methanol, 2,3,5,7a-tetrahydro-1-hydroxy-, (1S-cis)-
- 1H-pyrrolizine-7-methanol, 2,3,5,7a-tetrahydro-1-hydroxy-, (1S,7aR)-
- Heliotridine (8CI)
- (1S,7aR)-7-(Hydroxymethyl)-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Heliotridin
CAS:<p>Heliotridin is a pyrrolizidine alkaloid, which is a naturally occurring compound derived from certain plants, particularly those belonging to the Boraginaceae family. These alkaloids are known for their ability to form toxic metabolites in the liver, affecting cellular macromolecules. Heliotridin's mode of action involves the bioactivation by hepatic enzymes, resulting in the formation of reactive metabolites that can bind to DNA and other cellular proteins. This process leads to cytotoxic effects, making it a compound of significant toxicological interest. Researchers investigate Heliotridin primarily to explore its toxicological pathways and the potential risks associated with exposure in both humans and livestock. Understanding these mechanisms aids in assessing the impact of pyrrolizidine alkaloids in food safety and public health contexts, especially considering their presence in some herbal remedies and food products contaminated with plant material containing these alkaloids. The study of Heliotridin and similar compounds is crucial for the development of safety guidelines and regulatory policies to mitigate exposure risks.</p>Formula:C8H13NO2Purity:Min. 95%Molecular weight:155.19 g/mol
