CAS 520-65-0

(3Z,5R,6R,9aS,10S,14aR,14bR)-3-Ethylidenedodecahydro-6,10-dihydroxy-5,6-dimethyl[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione

Description:

The chemical substance with the name "(3Z,5R,6R,9aS,10S,14aR,14bR)-3-Ethylidenedodecahydro-6,10-dihydroxy-5,6-dimethyl[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione" and CAS number "520-65-0" is known as a complex organic compound. It features a unique bicyclic structure that includes multiple stereocenters, contributing to its specific three-dimensional configuration. The presence of hydroxyl groups indicates that it is likely to exhibit polar characteristics, which can influence its solubility in various solvents. The compound's dioxacyclododecino framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its intricate structure may also imply interesting reactivity patterns, making it a subject of interest for synthetic chemists. Additionally, the presence of an ethylidene group and multiple methyl groups can affect its physical properties, such as boiling and melting points, as well as its stability under different conditions. Overall, this compound exemplifies the complexity and diversity found in organic chemistry.

Formula: C₁₈H₂₇NO₆

InChI: InChI=1S/C18H27NO6/c1-4-11-7-10(2)18(3,23)17(22)24-9-12-13(20)8-19-6-5-14(15(12)19)25-16(11)21/h4,10,12-15,20,23H,5-9H2,1-3H3/b11-4-/t10-,12+,13-,14-,15-,18-/m1/s1

InChI key: InChIKey=YEXVXKIMPBHRQR-VFQWDWSUSA-N

SMILES: O[C@H]1[C@]2([C@]3(N(C1)CC[C@]3(OC(=O)/C(=C\C)/C[C@@H](C)[C@@](C)(O)C(=O)OC2)[H])[H])[H]

Synonyms:

• Rosmarinine
• [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidenedodecahydro-6,10-dihydroxy-5,6-dimethyl-, (3Z,5R,6R,9aS,10S,14aR,14bR)-
• [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine, senecionan-11,16-dione deriv.
• Senecionan-11,16-dione, 1,2-dihydro-2,12-dihydroxy-, (1α,2α)-
• (3Z,5R,6R,9aS,10S,14aR,14bR)-3-Ethylidenedodecahydro-6,10-dihydroxy-5,6-dimethyl[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione

Rosmarinine

CAS: 520-65-0

Rosmarinine is a non-toxic pyrrolizidine alkaloid.

Formula: C₁₈H₂₇NO₆

Color and Shape: Solid

Molecular weight: 353.41

Ref: TM-T34391

Rosmarinine

CAS: 520-65-0

Formula: C₁₈H₂₇NO₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 353.415

Ref: BP-BPC0412

Rosmarinine

CAS: 520-65-0

Rosmarinine is a natural terpene alkaloid, which is primarily derived from the plant Rosmarinus officinalis, commonly known as rosemary. This compound is biosynthesized through specialized pathways within the plant, involving the modification of geranyl diphosphate and various enzymatic processes that convert it into its final alkaloid form.

Formula: C₁₈H₂₇NO₆

Purity: Min. 95%

Molecular weight: 353.4 g/mol

Ref: 3D-AAA52065