CAS 520-85-4

Medroxyprogesterone

Description:

Medroxyprogesterone is a synthetic progestin, a type of hormone that mimics the effects of natural progesterone. It is primarily used in various medical applications, including hormone replacement therapy, contraception, and the treatment of certain menstrual disorders. Medroxyprogesterone is characterized by its ability to regulate ovulation and menstruation, making it effective in managing conditions like endometriosis and abnormal uterine bleeding. The substance is typically administered in oral or injectable forms, with the injectable form often providing prolonged effects. Chemically, it is a derivative of 17α-hydroxyprogesterone and features a modified steroid structure that enhances its stability and bioavailability. Medroxyprogesterone acts by binding to progesterone receptors, influencing gene expression and cellular activity in target tissues. Its pharmacokinetics include a relatively long half-life, allowing for less frequent dosing in clinical settings. As with any medication, it may have side effects, and its use should be monitored by healthcare professionals to ensure safety and efficacy.

Formula:C₂₂H₃₂O₃

InChI:InChI=1S/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1

InChI key:InChIKey=FRQMUZJSZHZSGN-HBNHAYAOSA-N

SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C([C@@H](C)C3)=CC(=O)CC4)(CC1)[H])[H])(CC[C@@]2(C(C)=O)O)[H]

Synonyms: