CAS 52000-32-5
:7-Mercaptoheptanoic acid
Description:
7-Mercaptoheptanoic acid is an organic compound characterized by the presence of both a thiol (-SH) and a carboxylic acid (-COOH) functional group. Its molecular structure consists of a seven-carbon aliphatic chain with a thiol group located at the seventh carbon, making it a member of the mercapto fatty acids. This compound is typically a colorless to pale yellow liquid or solid, depending on its state and purity. It is soluble in polar solvents due to the presence of the carboxylic acid group, while the thiol group contributes to its reactivity, particularly in forming disulfide bonds and participating in various chemical reactions. 7-Mercaptoheptanoic acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in the synthesis of thiol-functionalized materials and as a ligand in coordination chemistry. Additionally, its unique properties make it a candidate for use in drug delivery systems and as a biochemical probe. Safety precautions should be taken when handling this compound, as thiols can have strong odors and may be toxic in certain concentrations.
Formula:C7H14O2S
InChI:InChI=1S/C7H14O2S/c8-7(9)5-3-1-2-4-6-10/h10H,1-6H2,(H,8,9)
InChI key:InChIKey=AZJTUYPIWZAMTM-UHFFFAOYSA-N
SMILES:C(CCCCS)CC(O)=O
Synonyms:- ω-Mercaptoheptanoic acid
- heptanoic acid, 7-mercapto-
- Heptanoic acid, 7-mercapto-
- 7-Mercaptoheptanoic acid
- 7-Sulfanylheptanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-Sulfanylheptanoic acid
CAS:<p>7-Sulfanylheptanoic acid is a hydroxylated β-amino acid with a macrocyclic structure. It is the most abundant amino acid in human urine and has been shown to have insulin-like hypoglycemic effects in animal models. 7-Sulfanylheptanoic acid also has anti-inflammatory properties that may be due to its ability to inhibit the production of proinflammatory cytokines, such as tumor necrosis factor alpha (TNFα) and interleukin-1β (IL-1β). This compound has been found in influenza virus. The gene product for this compound is 3-mercaptopropionic acid reductase, which is involved in fatty acid metabolism.</p>Formula:C7H14O2SPurity:Min. 95%Molecular weight:162.25 g/mol
