CAS 52007-97-3
:N-(2-phenylethyl)propan-2-amine
Description:
N-(2-phenylethyl)propan-2-amine, also known as a substituted amine, is characterized by its structural features, which include a propan-2-amine backbone with a phenylethyl group attached to the nitrogen atom. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. It may appear as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its reactivity and interaction with biological systems. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to various bioactive molecules. Additionally, its safety profile and potential toxicity should be evaluated in accordance with standard chemical safety practices, as with any amine derivative. Overall, N-(2-phenylethyl)propan-2-amine represents a class of compounds with diverse chemical behavior and potential applications.
Formula:C11H17N
InChI:InChI=1/C11H17N/c1-10(2)12-9-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
SMILES:CC(C)NCCc1ccccc1
Synonyms:- (2-Phenylethyl)(Propan-2-Yl)Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2-Phenylethyl)(propan-2-yl)amine
CAS:Controlled Product<p>(2-Phenylethyl)(propan-2-yl)amine is a chiral compound that has two hydroxyl groups. It is used as a reagent in the synthesis of glycol ethers and in the preparation of bidentate ligands, such as 2-(pyridin-2-yl)ethanol. The nitro group on the molecule is readily reduced to an amine, which can undergo nucleophilic substitution reactions. This type of reaction is used to produce heterocyclic amines and cannabinoid compounds. (2-Phenylethyl)(propan-2-yl)amine has been shown to be an agonist at certain types of receptors, including benzodiazepine and imidazoline receptors.</p>Formula:C11H17NPurity:Min. 95%Molecular weight:163.26 g/mol

