CAS 52024-29-0

6-morpholino-3-pyridinyl isothiocyanate

Description:

6-Morpholino-3-pyridinyl isothiocyanate is a chemical compound characterized by its isothiocyanate functional group, which is known for its reactivity and biological activity. This compound features a pyridine ring substituted with a morpholino group and an isothiocyanate moiety, contributing to its potential applications in medicinal chemistry and as a biochemical probe. Isothiocyanates are often recognized for their role in plant defense mechanisms and have been studied for their anticancer properties. The presence of the morpholino group enhances solubility and may influence the compound's interaction with biological targets. Additionally, the compound's structure suggests potential for nucleophilic attack due to the electrophilic nature of the isothiocyanate group, making it a candidate for further research in drug development and chemical biology. Its CAS number, 52024-29-0, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmacology and agrochemistry.

Formula: C₁₀H₁₁N₃OS

InChI: InChI=1/C10H11N3OS/c15-8-12-9-1-2-10(11-7-9)13-3-5-14-6-4-13/h1-2,7H,3-6H2

SMILES: c1cc(ncc1N=C=S)N1CCOCC1

Synonyms:

• 4-(5-Isothiocyanatopyridin-2-Yl)Morpholine
• 4-(5-Isothiocyanato-2-Pyridyl)Morpholine

6-morpholino-3-pyridinyl isothiocyanate

CAS: 52024-29-0

Formula: C₁₀H₁₁N₃OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 221.2788

Ref: IN-DA00DCL1

4-(5-Isothiocyanatopyridin-2-yl)morpholine

CAS: 52024-29-0

4-(5-Isothiocyanatopyridin-2-yl)morpholine

Purity: ≥95%

Color and Shape: Purple Solid

Molecular weight: 221.28g/mol

Ref: 54-OR23274

4-(5-Isothiocyanatopyridin-2-yl)morpholine

CAS: 52024-29-0

Formula: C₁₀H₁₁N₃OS

Purity: 98%

Molecular weight: 221.28

Ref: 10-F092970