CAS 52033-71-3

2-Nonyl-N-(2-nonylphenyl)benzenamine

Description:

2-Nonyl-N-(2-nonylphenyl)benzenamine, with the CAS number 52033-71-3, is an organic compound characterized by its amine functional group and hydrophobic hydrocarbon chains. This substance features a nonyl group, which contributes to its lipophilicity, making it soluble in non-polar solvents. The presence of the phenyl ring enhances its stability and may influence its reactivity and interaction with other chemical species. Typically, compounds like this are used in various applications, including as surfactants, additives, or intermediates in the synthesis of more complex molecules. Its structure suggests potential applications in the formulation of lubricants or as a dispersant in industrial processes. Additionally, the compound's hydrophobic nature may affect its environmental behavior, including its bioaccumulation potential and degradation pathways. Safety data should be consulted to understand its toxicity and handling requirements, as amines can exhibit varying degrees of reactivity and health effects. Overall, 2-Nonyl-N-(2-nonylphenyl)benzenamine is a complex organic molecule with specific properties that make it suitable for various industrial applications.

Formula: C₃₀H₄₇N

InChI: InChI=1S/C30H47N/c1-3-5-7-9-11-13-15-21-27-23-17-19-25-29(27)31-30-26-20-18-24-28(30)22-16-14-12-10-8-6-4-2/h17-20,23-26,31H,3-16,21-22H2,1-2H3

InChI key: InChIKey=DMLQDPIAVJTTKJ-UHFFFAOYSA-N

SMILES: N(C1=C(CCCCCCCCC)C=CC=C1)C2=C(CCCCCCCCC)C=CC=C2

Synonyms:

• Benzenamine, 2-nonyl-N-(2-nonylphenyl)-
• 2-Nonyl-N-(2-nonylphenyl)benzenamine

Diphenylamine Impurity 4

CAS: 52033-71-3

Formula: C₃₀H₄₇N

Molecular weight: 421.71

Ref: 4Z-D-103015