CAS 52034-92-1
:dicyclohexylacetic acid
Description:
Dicyclohexylacetic acid is an organic compound characterized by its unique structure, which features two cyclohexyl groups attached to an acetic acid moiety. This compound typically appears as a white to off-white solid and is known for its relatively high melting point. It is sparingly soluble in water but more soluble in organic solvents such as ethanol and ether. Dicyclohexylacetic acid exhibits properties typical of carboxylic acids, including the ability to form hydrogen bonds, which contributes to its solubility characteristics and reactivity. It can participate in various chemical reactions, such as esterification and amidation, making it useful in organic synthesis. Additionally, this compound may have applications in pharmaceuticals and materials science due to its potential as a building block in the synthesis of more complex molecules. Safety data indicates that, like many organic acids, it should be handled with care to avoid skin and eye irritation. Overall, dicyclohexylacetic acid is a versatile compound with distinct physical and chemical properties.
Formula:C14H24O2
InChI:InChI=1/C14H24O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-13H,1-10H2,(H,15,16)
SMILES:C1CCC(CC1)C(C1CCCCC1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dicyclohexylacetic acid, 98+%
CAS:<p>It is used as pharmaceutical intermediate. Benzoylthiophenes are allosteric enhancers (AE) of agonist activity at the A1 adenosine receptor. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to t</p>Formula:C14H24O2Purity:98+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:224.342,2-Dicyclohexylacetic acid
CAS:Formula:C14H24O2Purity:98%Color and Shape:SolidMolecular weight:224.3392Dicyclohexylacetic acid
CAS:<p>Dicyclohexylacetic acid is an organic compound that is used as a reagent to measure the binding constants of proteins. It has a hydrophobic effect, which may be due to its particle size, and it has been shown to have antioxidant properties. Dicyclohexylacetic acid is also used in the production of chemical structures, such as hydrogen bond and carboxylate. It can be used in the treatment of autoimmune diseases by inhibiting serine protease activity and radiation therapy. Naphthenic acids are found in crude oil, and FT-IR spectroscopy can be used to detect these acids.</p>Formula:C14H24O2Purity:Min. 95%Molecular weight:224.35 g/mol




