CAS 5205-36-7

N-[10-(3-formylphenoxy)-1,2-bis(4-hydroxybutyl)-4-{[(4-nitrobenzyl)oxy]imino}-6a-(prop-2-en-1-yloxy)-1,2,4,5,6,6a,11b,11c-octahydrobenzo[kl]xanthen-6-yl]-N-methylquinoline-8-sulfonamide

Description:

The chemical substance N-[10-(3-formylphenoxy)-1,2-bis(4-hydroxybutyl)-4-{[(4-nitrobenzyl)oxy]imino}-6a-(prop-2-en-1-yloxy)-1,2,4,5,6,6a,11b,11c-octahydrobenzo[kl]xanthen-6-yl]-N-methylquinoline-8-sulfonamide, with CAS number 5205-36-7, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as sulfonamide, aldehyde, and hydroxy groups. This compound is likely to exhibit significant biological activity due to its structural features, which may contribute to interactions with biological targets. The presence of the quinoline moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular architecture. Its synthesis and characterization would require advanced organic chemistry techniques, and it may be of interest in research fields such as drug development, materials science, or biochemistry. However, specific properties such as melting point, boiling point, and solubility would need to be determined experimentally.

Formula: C₅₁H₅₄N₄O₁₁S

InChI: InChI=1/C51H54N4O11S/c1-3-27-63-51-47(54(2)67(61,62)46-17-9-13-36-14-10-24-52-50(36)46)31-44(53-64-33-34-18-20-38(21-19-34)55(59)60)42-29-37(12-4-6-25-56)41(16-5-7-26-57)48(49(42)51)43-30-40(22-23-45(43)66-51)65-39-15-8-11-35(28-39)32-58/h3,8-11,13-15,17-24,28-30,32,37,41,47-49,56-57H,1,4-7,12,16,25-27,31,33H2,2H3

SMILES: C=CCOC12C(CC(=NOCc3ccc(cc3)N(=O)=O)C3=CC(CCCCO)C(CCCCO)C(c4cc(ccc4O2)Oc2cccc(c2)C=O)C13)N(C)S(=O)(=O)c1cccc2cccnc12

sec-Butyl 2-Bromoacetate

Controlled Product

CAS: 5205-36-7

Formula: C₆H₁₁BrO₂

Color and Shape: Neat

Molecular weight: 195.054

Ref: TR-B694120

Sec-butyl 2-bromoacetate

CAS: 5205-36-7

Please enquire for more information about Sec-butyl 2-bromoacetate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 195.05 g/mol

Ref: 3D-FAA20536