CAS 520505-01-5

2-(5,7,8,9-Tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)acetic acid

Description:

2-(5,7,8,9-Tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)acetic acid, with the CAS number 520505-01-5, is a chemical compound characterized by its unique bicyclic structure, which includes a benzocycloheptene moiety. This compound features a tetrahydrobenzocycloheptene ring system, contributing to its potential biological activity. The presence of a hydroxyl group enhances its polarity and may influence its solubility in various solvents, while the acetic acid functional group suggests potential for acid-base interactions. The compound's structural complexity may impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may exhibit specific reactivity patterns due to the presence of the ylidene and hydroxyl functionalities. Overall, this compound's unique structure and functional groups could lead to diverse applications in pharmaceuticals or materials science, although specific biological activities and applications would require further investigation.

Formula: C₁₃H₁₄O₃

InChI: InChI=1S/C13H14O3/c14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)13(10)16/h1-2,4,7-8,13,16H,3,5-6H2,(H,14,15)

InChI key: InChIKey=UADPGHINQMWEAG-UHFFFAOYSA-N

SMILES: OC1C=2C(CCCC1=CC(O)=O)=CC=CC2

Synonyms:

• 2-[5-Hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-ylidene]acetic acid
• NCS 382
• Acetic acid, 2-(5,7,8,9-tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)-
• 2-(5,7,8,9-Tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)acetic acid
• Acetic acid, (5,7,8,9-tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)-

NCS-382

CAS: 520505-01-5

NCS-382 is a competitive antagonist specifically targeting the γ-hydroxybutyric acid (GHB) receptor, which is a type of biological molecule involved in neuromodulation. It is primarily sourced from synthetic chemical processes in laboratory settings, allowing for precise control over its purity and concentration.

Formula: C₁₃H₁₄O₃

Purity: Min. 95%

Molecular weight: 218.25 g/mol

Ref: 3D-VVA50501

NCS-382

CAS: 520505-01-5

γ-Hydroxybutyric acid antagonist

Formula: C₁₃H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.25

Ref: TM-T23060