CymitQuimica logo

CAS 52059-53-7

:

3-Fluorophenethyl alcohol

Description:
3-Fluorophenethyl alcohol, with the CAS number 52059-53-7, is an organic compound characterized by the presence of a fluorine atom on the phenyl ring and a hydroxyl group (-OH) attached to an ethyl side chain. This compound typically exhibits a colorless to pale yellow liquid form and has a moderate boiling point, indicative of its molecular weight and structure. The presence of the fluorine atom can influence its chemical reactivity, polarity, and solubility in various solvents. 3-Fluorophenethyl alcohol is likely to participate in hydrogen bonding due to the hydroxyl group, which can enhance its solubility in polar solvents. Additionally, it may exhibit unique biological activities, making it of interest in medicinal chemistry and pharmaceuticals. Its synthesis often involves the introduction of the fluorine substituent onto the phenethyl alcohol framework through various fluorination methods. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C8H9FO
InChI:InChI=1/C8H9FO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2
InChI key:MZNBGEKFZCWVES-UHFFFAOYSA-N
SMILES:c1cc(CCO)cc(c1)F
Synonyms:
  • 2-(3-Fluorophenyl)ethylalcohol
  • 3-Fluorophenylethanol
Found 6 products.