CAS 5206-34-8

2-pyridin-4-ylquinoline-4-carbohydrazide

Description:

2-Pyridin-4-ylquinoline-4-carbohydrazide, with the CAS number 5206-34-8, is a chemical compound that features a quinoline core substituted with a pyridine group and a carbohydrazide functional group. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural motifs that may interact with biological targets. The presence of both the pyridine and quinoline rings suggests potential for aromatic interactions, which can influence its solubility and reactivity. Additionally, the carbohydrazide moiety may impart properties related to hydrogen bonding and reactivity towards electrophiles. The compound's synthesis often involves multi-step organic reactions, and it may be characterized by techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-pyridin-4-ylquinoline-4-carbohydrazide represents a class of heterocyclic compounds that are of interest in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₂N₄O

InChI: InChI=1/C15H12N4O/c16-19-15(20)12-9-14(10-5-7-17-8-6-10)18-13-4-2-1-3-11(12)13/h1-9H,16H2,(H,19,20)

SMILES: c1ccc2c(c1)c(cc(c1ccncc1)n2)C(=NN)O

Synonyms:

• 2-(Pyridin-4-yl)quinoline-4-carbohydrazide
• 2-Pyridin-4-yl-quinoline-4-carboxylic acid hydrazide
• 4-Quinolinecarboxylic acid, 2-(4-pyridinyl)-, hydrazide

2-Pyridin-4-ylquinoline-4-carboxylic acidhydrazide

CAS: 5206-34-8

Molecular weight: 264.2879943847656

Ref: 10-F014622