CAS 52061-75-3: 2,2-Dipropylpentanoic acid
Description:2,2-Dipropylpentanoic acid, with the CAS number 52061-75-3, is a branched-chain carboxylic acid characterized by its unique structure, which includes a pentanoic acid backbone with two propyl groups attached to the second carbon. This configuration contributes to its hydrophobic nature, making it less soluble in water compared to straight-chain carboxylic acids. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. The compound is typically a colorless liquid or solid at room temperature, depending on its purity and specific conditions. Its molecular structure influences its boiling and melting points, which are generally higher than those of simpler carboxylic acids due to increased molecular weight and branching. 2,2-Dipropylpentanoic acid may find applications in organic synthesis, as a building block in the production of pharmaceuticals, or in the formulation of specialty chemicals. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C11H22O2
InChI:InChI=1S/C11H22O2/c1-4-7-11(8-5-2,9-6-3)10(12)13/h4-9H2,1-3H3,(H,12,13)
InChI key:InChIKey=UMJGAWHIMHSGMU-UHFFFAOYSA-N
SMILES:O=C(O)C(CCC)(CCC)CCC
- Synonyms:
- 2,2-Dipropyl-valeric acid
- 2,2-Dipropylpentanoic Acid
- Pentanoic acid, 2,2-dipropyl-
- Tripropylacetic acid
- Valeric acid, 2,2-dipropyl-
- 2,2-Dipropylvaleric acid
