CAS 52061-75-3
:2,2-Dipropylpentanoic acid
Description:
2,2-Dipropylpentanoic acid, with the CAS number 52061-75-3, is a branched-chain carboxylic acid characterized by its unique structure, which includes a pentanoic acid backbone with two propyl groups attached to the second carbon. This configuration contributes to its hydrophobic nature, making it less soluble in water compared to straight-chain carboxylic acids. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. The compound is typically a colorless liquid or solid at room temperature, depending on its purity and specific conditions. Its molecular structure influences its boiling and melting points, which are generally higher than those of simpler carboxylic acids due to increased molecular weight and branching. 2,2-Dipropylpentanoic acid may find applications in organic synthesis, as a building block in the production of pharmaceuticals, or in the formulation of specialty chemicals. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C11H22O2
InChI:InChI=1S/C11H22O2/c1-4-7-11(8-5-2,9-6-3)10(12)13/h4-9H2,1-3H3,(H,12,13)
InChI key:InChIKey=UMJGAWHIMHSGMU-UHFFFAOYSA-N
SMILES:C(CCC)(CCC)(CCC)C(O)=O
Synonyms:- 2,2-Dipropyl-valeric acid
- 2,2-Dipropylpentanoic Acid
- Pentanoic acid, 2,2-dipropyl-
- Tripropylacetic acid
- Valeric acid, 2,2-dipropyl-
- 2,2-Dipropylvaleric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,2-Dipropylpentanoic acid
CAS:Formula:C11H22O2Purity:95%Color and Shape:SolidMolecular weight:186.2912Valproic Acid EP Impurity D
CAS:Formula:C11H22O2Color and Shape:White To Off-White SolidMolecular weight:186.292,2-Dipropylpentanoic Acid
CAS:Controlled ProductFormula:C11H22O2Color and Shape:NeatMolecular weight:186.292,2-Dipropylpentanoic acid
CAS:2,2-Dipropylpentanoic acid is a white crystalline solid with a melting point of -51°C. It has a hydroxyl group and an ester linkage. The chemical formula is CH3(CH2)3COOC3H7. It has a molecular weight of 182.27 g/mol and a density of 1.071 g/cm3. It is soluble in organic solvents such as chloroform, ether, benzene, acetone, and carbon tetrachloride but insoluble in water. 2,2-Dipropylpentanoic acid can be used as a catalyst for the synthesis of polymers from monocarboxylic acids and chloride or magnesium halides. This compound also has antidepressant activity by inhibiting the reuptake of serotonin from the synapse into the presynaptic neuron.Formula:C11H22O2Purity:Min. 95%Molecular weight:186.29 g/mol







