CAS 52062-92-7
:4-(2-Bromoethyl)benzoic acid
Description:
4-(2-Bromoethyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a bromoethyl group at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic ring. The presence of the bromoethyl group introduces both electrophilic and nucleophilic reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Overall, 4-(2-Bromoethyl)benzoic acid serves as a versatile intermediate in organic synthesis and research applications.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4H,5-6H2,(H,11,12)
InChI key:InChIKey=BKMRWJWLBHHGCF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(CCBr)C=C1
Synonyms:- 2-[4-Carboxyphenyl]ethyl bromide
- 4-(2-Bromoethyl)benzoic acid
- Benzoic acid, 4-(2-bromoethyl)-
- Benzoic acid, p-(2-bromoethyl)-
- p-(2-Bromoethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(2-Bromoethyl)benzoic Acid
CAS:Formula:C9H9BrO2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:229.074-(2-BROMOETHYL)BENZOIC ACID
CAS:Formula:C9H9BrO2Purity:97%Color and Shape:SolidMolecular weight:229.07064-(2-Bromoethyl)-benzoic acid
CAS:4-(2-Bromoethyl)-benzoic acid is a carboxylic acid that has been shown to be optimal for the treatment of Staphylococcus aureus. The experimental studies have been performed in vitro and in vivo, on both bacteria and animal models. 4-(2-Bromoethyl)-benzoic acid is active against staphylococcal infections, including those caused by methicillin resistant strains. 4-(2-Bromoethyl)-benzoic acid has also been shown to be effective against other bacterial species, such as Escherichia coli, Pseudomonas aeruginosa and Klebsiella pneumoniae. This compound inhibits the growth of bacteria by blocking the synthesis of proteins needed for cell division.Formula:C9H9BrO2Purity:Min. 95%Color and Shape:PowderMolecular weight:229.07 g/mol4-(2-Bromoethyl)benzoic acid
CAS:Formula:C9H9BrO2Purity:95.0%Color and Shape:SolidMolecular weight:229.073




