CAS 52065-78-8
:2,5-Piperidinedione
Description:
2,5-Piperidinedione, also known as 2,5-diketopiperidine, is a cyclic compound characterized by a six-membered ring containing two carbonyl groups (ketones) at the 2 and 5 positions. This compound is a derivative of piperidine, a saturated six-membered nitrogen-containing heterocycle. The presence of the two carbonyl groups contributes to its reactivity, making it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. 2,5-Piperidinedione exhibits a range of chemical properties, including the ability to undergo nucleophilic addition reactions due to the electrophilic nature of the carbonyl groups. It is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. The compound's structure allows for various functionalizations, which can lead to the formation of diverse derivatives with potential biological activity. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C5H7NO2
InChI:InChI=1/C5H7NO2/c7-4-1-2-5(8)6-3-4/h1-3H2,(H,6,8)
SMILES:C1CC(=NCC1=O)O
Synonyms:- Piperidine-2,5-dione
- 52065-78-8
- 2,5-Piperidinedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Piperidine-2,5-dione
CAS:Piperidine-2,5-dioneFormula:C5H7NO2Purity:95%Color and Shape: grey solidMolecular weight:113.11g/molPiperidine-2,5-dione
CAS:Piperidine-2,5-dione is a synthetic compound that is used for the synthesis of benzyl esters, stereospecific chiral compounds, and amides. It can be used as a building block in the synthesis of natural products. Piperidine-2,5-dione has been shown to inhibit the activity of enzymes such as lactamases and amidases. The mechanism by which piperidine-2,5-dione inhibits these enzymes is not yet known. This compound also can react with potassium hydride to form radical species or alkylate boronic acids to form stereochemically pure products.
Formula:C5H7NO2Purity:Min. 95%Molecular weight:113.11 g/mol


