CAS 5207-52-3: 5,6-diphenylfuro[2,3-d]pyrimidin-4-amine
Description:5,6-Diphenylfuro[2,3-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its fused ring structure, which includes both furan and pyrimidine moieties. This compound features two phenyl groups attached to the furan ring, contributing to its aromatic character and potentially influencing its electronic properties. The presence of an amine functional group at the 4-position of the pyrimidine ring enhances its reactivity and solubility in polar solvents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit interesting photophysical properties, making it a candidate for use in organic electronics or as a fluorescent probe. Additionally, its structural complexity and the presence of multiple functional groups can lead to diverse chemical behavior, including potential interactions with various reagents and substrates in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H13N3O
InChI:InChI=1/C18H13N3O/c19-17-15-14(12-7-3-1-4-8-12)16(13-9-5-2-6-10-13)22-18(15)21-11-20-17/h1-11H,(H2,19,20,21)
- Synonyms:
- Furo[2,3-d]pyrimidin-4-amine, 5,6-diphenyl-
- 5,6-Diphenylfuro[2,3-d]pyrimidin-4-amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5,6-DIPHENYLFURO[2,3-D]PYRIMIDIN-4-AMINE REF: IN-DA00DCYICAS: 5207-52-3 | - - - | To inquire | Mon 14 Apr 25 |
![]() | 5,6-diphenylfuro[2,3-d]pyrimidin-4-amine REF: 10-F366760CAS: 5207-52-3 | - - - | - - - | Discontinued product |
![]() | 5,6-Diphenylfuro[2,3-d]pyrimidin-4-amine REF: 3D-FD117450CAS: 5207-52-3 | Min. 95% | - - - | Discontinued product |

Ref: 10-F366760
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information |

5,6-Diphenylfuro[2,3-d]pyrimidin-4-amine
Ref: 3D-FD117450
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |