CAS 52071-65-5
:Boc-Pro-Phe-OH
Description:
Boc-Pro-Phe-OH, also known as Boc-proline phenylalanine hydroxyl, is a protected amino acid derivative commonly used in peptide synthesis. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions without interfering with other functional groups. This compound features a proline residue linked to a phenylalanine residue, making it a valuable building block in the synthesis of peptides and proteins. Its structure includes a carboxylic acid group, which is essential for peptide bond formation. Boc-Pro-Phe-OH is typically white to off-white in appearance and is soluble in organic solvents like dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. The compound is stable under standard laboratory conditions but should be stored in a cool, dry place to prevent degradation. Its applications extend to pharmaceutical research, particularly in the development of peptide-based drugs and in studies involving protein folding and interactions.
Formula:C19H26N2O5
InChI:InChI=1/C19H26N2O5/c1-19(2,3)26-18(25)21-11-7-10-15(21)16(22)20-14(17(23)24)12-13-8-5-4-6-9-13/h4-6,8-9,14-15H,7,10-12H2,1-3H3,(H,20,22)(H,23,24)/t14?,15-/m1/s1
SMILES:CC(C)(C)OC(=O)N1CCC[C@@H]1C(=NC(Cc1ccccc1)C(=O)O)O
Synonyms:- 2-[[(2R)-1-tert-butoxycarbonylpyrrolidine-2-carbonyl]amino]-3-phenyl-propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Boc-Pro-Phe-OH
CAS:Boc-Pro-Phe-OH is an ionic liquid that contains a chloride anion. It has been shown to have the ability to dissolve organic compounds, such as 1-methylimidazole, imidazolium, proline, and chloride ions. It has been observed using FTIR and mass spectroscopy that Boc-Pro-Phe-OH forms hydrogen bonds with the chloride ion. The thermal stability of Boc-Pro-Phe-OH has been measured at 250°C for one hour in air with no decomposition observed. This compound also has a low vapor pressure and can be stored in a liquid state at room temperature.Formula:C19H26N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:362.42 g/mol


