
CAS 52090-80-9
:5-Methyl-3-nitro-1H-pyrazolo[4,3-b]pyridine
Description:
5-Methyl-3-nitro-1H-pyrazolo[4,3-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo and pyridine rings. This compound features a methyl group and a nitro group, which contribute to its chemical reactivity and potential applications. The presence of the nitro group typically enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyrazolo[4,3-b]pyridine structure is known for its biological activity, often being investigated for potential pharmaceutical applications, including anti-inflammatory and antimicrobial properties. The compound is generally stable under standard conditions but may require careful handling due to the presence of the nitro group, which can be sensitive to reduction. Its solubility and reactivity can vary depending on the solvent and conditions used. Overall, 5-Methyl-3-nitro-1H-pyrazolo[4,3-b]pyridine is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential biological activities.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c1-4-2-3-5-6(8-4)7(10-9-5)11(12)13/h2-3H,1H3,(H,9,10)
InChI key:InChIKey=BHPDCGSYDKSSMP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NN1)=CC=C(C)N2
Synonyms:- 1H-Pyrazolo[4,3-b]pyridine, 5-methyl-3-nitro-
- 5-Methyl-3-nitro-1H-pyrazolo[4,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
