CAS 52090-89-8

5-chloro-1H-imidazo[4,5-b]pyridine

Description:

5-Chloro-1H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position of the imidazo ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution reactions, which can be exploited to modify its pharmacological properties. Additionally, 5-chloro-1H-imidazo[4,5-b]pyridine may participate in hydrogen bonding and π-π stacking interactions, influencing its behavior in biological systems. The compound's molecular weight and specific functional groups contribute to its overall stability and reactivity, making it a valuable compound for research in fields such as organic synthesis and pharmacology. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-5-2-1-4-6(10-5)9-3-8-4/h1-3H,(H,8,9,10)

SMILES: c1cc(Cl)nc2c1nc[nH]2

Synonyms:

• 3H-imidazo[4,5-b]pyridine, 5-chloro-
• 5-chloro-3H-imidazo[4,5-b]pyridine

5-Chloro-3H-imidazo[4,5-b]pyridine

CAS: 52090-89-8

Formula: C₆H₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA0037BM

5-Chloro-3H-imidazo[4,5-b]pyridine

CAS: 52090-89-8

5-Chloro-3H-imidazo[4,5-b]pyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.56905g/mol

Ref: 54-OR305187

5-Chloro-3H-imidazo[4,5-b]pyridine

CAS: 52090-89-8

Formula: C₆H₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F077946