CymitQuimica logo

CAS 52092-43-0

:

2-Bromo-4-nitropyridine N-oxide

Description:
2-Bromo-4-nitropyridine N-oxide is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom and a nitro group, along with an N-oxide functional group. Its molecular formula typically includes carbon, hydrogen, nitrogen, oxygen, and bromine atoms, reflecting its complex structure. This compound is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in polar solvents and may display reactivity due to the presence of both the nitro and N-oxide groups, which can participate in various chemical reactions. Additionally, 2-Bromo-4-nitropyridine N-oxide may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as it may pose hazards typical of halogenated and nitro compounds, including potential toxicity and environmental concerns. Proper handling and storage conditions are essential to ensure safety when working with this substance.
Formula:C5H4BrN2O3
InChI:InChI=1/C5H4BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3,5H/q+1
InChI key:IRBDHXCXCSFNEQ-UHFFFAOYSA-N
SMILES:C1=CN(C(C=C1N(=O)=O)Br)O
Synonyms:
  • 2-Bromo-4-Nitropyridine 1-Oxide
  • 2-Bromo-4-Nitro-1-Oxo-1,2-Dihydropyridinium
  • 2-Bromo-4-nitropyridine-N-oxide
Found 5 products.