CAS 52092-65-6
:Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9,11-epoxy-16-methyl-, (9β,11β,16α)-
Description:
Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9,11-epoxy-16-methyl-, commonly known as a synthetic steroid, exhibits several notable characteristics. This compound is part of the steroid family, which is characterized by a four-ring carbon structure. The presence of the 1,4-diene and keto groups indicates its reactivity and potential biological activity, particularly in hormonal pathways. The acetyloxy group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. The epoxy group introduces a three-dimensional aspect to its structure, which may influence its interaction with biological receptors. This compound is often studied for its pharmacological properties, including anti-inflammatory and anabolic effects. Its stereochemistry, denoted by the (9β,11β,16α) configuration, plays a crucial role in determining its biological activity and specificity. Overall, this compound is significant in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents that mimic or modulate steroid hormone activity.
Formula:C24H30O5
InChI:InChI=1S/C24H30O5/c1-13-9-18-17-6-5-15-10-16(26)7-8-23(15,4)24(17)20(29-24)11-22(18,3)21(13)19(27)12-28-14(2)25/h7-8,10,13,17-18,20-21H,5-6,9,11-12H2,1-4H3/t13-,17+,18+,20+,21-,22+,23+,24-/m1/s1
InChI key:InChIKey=JKRMOSPJNPCGSZ-QNAHPZDQSA-N
SMILES:C[C@@]12[C@@]34[C@@](O3)(C[C@@]5(C)[C@]([C@@]4(CCC1=CC(=O)C=C2)[H])(C[C@@H](C)[C@@H]5C(COC(C)=O)=O)[H])[H]
Synonyms:- (9Beta,11Beta,16Alpha)-16-Methyl-3,20-Dioxo-9,11-Epoxypregna-1,4-Dien-21-Yl Acetate
- 9,11-Epoxy-9H-cyclopenta[a]phenanthrene, pregna-1,4-diene-3,20-dione deriv.
- 9beta,11beta-Epoxy-21-hydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-acetate
- 9β-Pregna-1,4-diene-3,20-dione, 9,11β-epoxy-21-hydroxy-16α-methyl-, acetate
- Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9,11-epoxy-16-methyl-, (9β,11β,16α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Desoximetasone Impurity 32
CAS:Formula:C24H30O5Color and Shape:White To Off-White SolidMolecular weight:398.5011,21-Didehydro-(9β,11β)-epoxy-21-(acetyloxy) Desoxymetasone-d3
CAS:Controlled ProductFormula:C24D3H27O5Color and Shape:NeatMolecular weight:401.5111,21-Didehydro-(9b,11b)-epoxy-21-(acetyloxy) Desoxymetasone
CAS:Controlled ProductFormula:C24H30O5Color and Shape:NeatMolecular weight:398.49

