CAS 52093-13-7

2-chloro-N'-(chloroacetyl)benzohydrazide

Description:

2-Chloro-N'-(chloroacetyl)benzohydrazide is an organic compound characterized by its hydrazide functional group, which is linked to a benzene ring. This compound features a chloroacetyl group and a chlorine atom, contributing to its reactivity and potential applications in various chemical reactions. It typically appears as a solid and may exhibit moderate solubility in organic solvents. The presence of chlorine atoms enhances its electrophilic character, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The compound's structure allows for potential interactions with biological systems, which may lead to interesting pharmacological properties. Safety considerations should be taken into account due to the presence of chlorine, which can pose health risks if not handled properly. Overall, 2-chloro-N'-(chloroacetyl)benzohydrazide is a versatile compound with significant implications in chemical research and industry.

Formula: C₉H₈Cl₂N₂O₂

InChI: InChI=1/C9H8Cl2N2O2/c10-5-8(14)12-13-9(15)6-3-1-2-4-7(6)11/h1-4H,5H2,(H,12,14)(H,13,15)

SMILES: c1ccc(c(c1)C(=NN=C(CCl)O)O)Cl

2-Chloro-N'-(2-chloroacetyl)benzohydrazide

CAS: 52093-13-7

2-Chloro-N'-(2-chloroacetyl)benzohydrazide

Purity: 95%

Molecular weight: 247.08g/mol

Ref: 54-OR1046596

2-Chloro-N'-(2-chloroacetyl)benzohydrazide

CAS: 52093-13-7

Versatile small molecule scaffold

Formula: C₉H₈Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 247.07 g/mol

Ref: 3D-CCA09313