CAS 52093-27-3
:Methanesulfonic acid, 1,1,1-trifluoro-, praseodymium(3+) salt (3:1)
Description:
Methanesulfonic acid, 1,1,1-trifluoro-, praseodymium(3+) salt (3:1) is a chemical compound characterized by its unique combination of a trifluoromethyl group and a praseodymium ion. The presence of the trifluoromethyl group enhances the compound's stability and solubility in polar solvents, making it useful in various chemical applications. As a salt of praseodymium, a rare earth element, it exhibits properties typical of lanthanide compounds, such as paramagnetism and the ability to form coordination complexes. The praseodymium ion in this compound typically exhibits a +3 oxidation state, which is common for lanthanides. This compound may be utilized in specialized applications, including catalysis, materials science, and potentially in the development of advanced electronic materials. Its unique properties stem from both the methanesulfonic acid moiety and the trifluoromethyl group, which can influence reactivity and interaction with other chemical species. Safety and handling precautions should be observed due to the potential hazards associated with both the trifluoromethyl group and the rare earth metal.
Formula:CHF3O3SPr
InChI:InChI=1S/CHF3O3S.Pr/c2-1(3,4)8(5,6)7;/h(H,5,6,7);
InChI key:InChIKey=DXZODPQHLDOQFU-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)(F)(F)F.[Pr]
Synonyms:- Methanesulfonic acid, 1,1,1-trifluoro-, praseodymium(3+) salt (3:1)
- Methanesulfonic acid, trifluoro-, praseodymium(3+) salt
- Praseodymium triflate
- Praseodymium tris(trifluoromethanesulfonate)
- Praseodymium(3+) tris(trifluoromethyl sulfate)
- Praseodymium(III) triflate
- Praseodymium(III) trifluoromethanesulfonate
- Praseodymium(III) trifluoromethanesulphonate
- Trifluoromethanesulfonic Acid - Praseodymium (1:1)
- Trifluoromethanesulfonic acid praseodymium(3+) salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Praseodymium(III) trifluoromethanesulfonate, 98%
CAS:It is a water-tolerant Lewis acid used in the Aldol reaction of silyl enol ethers with aldehydes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prFormula:C3F9O9PrS3Purity:98%Color and Shape:PowderMolecular weight:588.10Praseodymium (III) Trifluoromethanesulfonate
CAS:Praseodymium (III) TrifluoromethanesulfonatePurity:≥95%Molecular weight:588.11g/molPraseodymium(III) trifluoromethanesulfonate, min. 98% (Praseodymium triflate)
CAS:Praseodymium(III) trifluoromethanesulfonate, min. 98% (Praseodymium triflate)
Formula:Pr(CF3SO3)3Purity:min. 98%Color and Shape:green pwdr.Molecular weight:588.12Praseodymium (III) Trifluoromethanesulfonate extrapure, 98%
CAS:Formula:Pr(OSO2CF3)3Purity:min. 98.0%Color and Shape:White to green, PowderMolecular weight:588.11Praseodymium(III) Triflate
CAS:Controlled ProductFormula:C3F9O9PrS3Color and Shape:NeatMolecular weight:588.11PRASEODYMIUM (III) TRIFLUOROMETHANESULFONATE
CAS:Formula:C3F9O9PrS3Purity:98%Color and Shape:SolidMolecular weight:588.1150






