CAS 52093-42-2
:1-(3-hydroxyphenyl)-2-(methylamino)ethanone
Description:
1-(3-Hydroxyphenyl)-2-(methylamino)ethanone, also known by its CAS number 52093-42-2, is an organic compound characterized by its structural features, which include a hydroxyl group (-OH) attached to a phenyl ring and a methylamino group (-NH(CH3)2) linked to an ethanone moiety. This compound typically exhibits properties associated with both phenolic and amine functionalities, which can influence its solubility, reactivity, and potential biological activity. It may be soluble in polar solvents due to the presence of the hydroxyl group, while the methylamino group can participate in hydrogen bonding and other interactions. The compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active molecules. Additionally, its unique combination of functional groups may impart specific characteristics such as antioxidant or antimicrobial properties, although detailed studies would be necessary to elucidate its full range of chemical behavior and potential applications.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,10-11H,6H2,1H3
InChI key:BDLRAEZKFVYJPW-UHFFFAOYSA-N
SMILES:CNCC(=O)c1cccc(c1)O
Synonyms:- 1-METHYLAMINO-3'-HYDROXYACETOPHENONE
- Ethanone, 1-(3-hydroxyphenyl)-2-(methylamino)-
- See more synonyms
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery