CAS 52099-78-2
:5-ethyl-1,3-dimethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione
Description:
5-Ethyl-1,3-dimethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione, with the CAS number 52099-78-2, is a pyrimidine derivative characterized by its unique structure that includes a pyrimidine ring substituted with ethyl, dimethyl, and phenyl groups, along with three carbonyl groups at positions 2, 4, and 6. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions. The presence of multiple substituents can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence or other optical properties, depending on its specific electronic structure. Its synthesis and applications may be relevant in fields such as pharmaceuticals, agrochemicals, or materials science, where pyrimidine derivatives are often explored for their diverse functionalities.
Formula:C14H16N2O3
InChI:InChI=1/C14H16N2O3/c1-4-14(10-8-6-5-7-9-10)11(17)15(2)13(19)16(3)12(14)18/h5-9H,4H2,1-3H3
SMILES:CCC1(c2ccccc2)C(=O)N(C)C(=O)N(C)C1=O
Synonyms:- 2,4,6(1H,3H,5H)-pyrimidinetrione, 5-ethyl-1,3-dimethyl-5-phenyl-
- Barbituric acid, 5-ethyl-1,3-dimethyl-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(3-isopropenyl-2-oxo-2,3-dihydro-1H-1,3-benzimidazol-1-yl)butanoic acid
CAS:Formula:C14H16N2O3Color and Shape:SolidMolecular weight:260.28843-Isopropenyl-2-oxo-1-benzimidazolinebutyric Acid
CAS:Controlled ProductApplications 3-Isopropenyl-2-oxo-1-benzimidazolinebutyric Acid (cas# 52099-78-2) is a compound useful in organic synthesis.
Formula:C14H16N2O3Color and Shape:NeatMolecular weight:260.29

