CAS 521-34-6
:Sciadopitysin
Description:
Sciadopitysin, with the CAS number 521-34-6, is a chemical compound classified as a flavonoid, specifically a flavanone. It is primarily derived from the Sciadopitys genus, commonly known as the Japanese umbrella pine. This compound exhibits several notable characteristics, including its potential antioxidant properties, which may contribute to its biological activities. Sciadopitysin has been studied for its effects on various cellular processes, including anti-inflammatory and anti-cancer activities, making it of interest in pharmacological research. The compound is typically characterized by its polyphenolic structure, which is common among flavonoids, allowing it to interact with various biological systems. Additionally, it may exhibit solubility in organic solvents, while its solubility in water is limited. As with many natural products, the extraction and purification of sciadopitysin can be complex, often requiring specific methodologies to isolate it from plant materials. Overall, sciadopitysin represents a fascinating area of study within natural product chemistry and its potential applications in health and medicine.
Formula:C33H24O10
InChI:InChI=1S/C33H24O10/c1-39-18-7-4-16(5-8-18)27-15-25(38)32-23(36)13-22(35)30(33(32)43-27)20-10-17(6-9-26(20)41-3)28-14-24(37)31-21(34)11-19(40-2)12-29(31)42-28/h4-15,34-36H,1-3H3
InChI key:InChIKey=YCXRBCHEOFVYEN-UHFFFAOYSA-N
SMILES:OC=1C(=C2C(C(=O)C=C(O2)C3=CC=C(OC)C=C3)=C(O)C1)C4=CC(=CC=C4OC)C=5OC=6C(C(=O)C5)=C(O)C=C(OC)C6
Synonyms:- 3′′′,8-Biflavone, 5,5′′,7-trihydroxy-4′,4′′′,7′′-trimethoxy-
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl]-2-(4-methoxyphenyl)-
- 5,7-Dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl]-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-2-(4-methoxyphenyl)-4H-chromen-4-one
- 7,4′,4′′′-Trimethylamentoflavone
- Amentoflavone-7,4',4'''-trimethyl ether
- Nsc 45108
- Sciadopitysin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)-2-methoxyphenyl]-2-(4-methoxyphenyl)chromen-4-one
CAS:Formula:C33H24O10Purity:98%Molecular weight:580.5377Sciadopitysin
CAS:Sciadopitysin shows protective effects on antimycin A-induced toxicity in osteoblastic MC3T3-E1 cells, it may reduce or prevent osteoblasts degeneration; it also may prevent the development of diabetic osteopathy, it exerts its therapeutic effects via upregulation of mitochondrial biogenesis. Sciadopitysin can inhibit the Aβ aggregation and reduce Aβ-induced toxicity in the primary cortical neurons.Formula:C33H24O10Purity:95%~99%Molecular weight:580.545Sciadopitysin
CAS:Sciadopitysin may thwart diabetic bone disease, boost mitochondria, protect osteoblasts, and hinder Aβ aggregation/neurotoxicity.Formula:C33H24O10Purity:98.67% - 99.17%Color and Shape:SolidMolecular weight:580.54Ref: TM-T5S2129
1mg49.00€5mg89.00€10mg154.00€25mg288.00€50mg432.00€100mg620.00€500mg1,279.00€1mL*10mM (DMSO)123.00€Sciadopitysin
CAS:Oxygen-heterocyclic compoundFormula:C33H24O10Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:580.55Sciadopitysin
CAS:<p>Sciadopitysin is a flavonoid compound, which is a bioactive substance, derived from the Japanese umbrella pine, Sciadopitys verticillata. This compound is characterized by its complex chemical structure with multiple potential pharmacological actions. As a natural product isolated from a unique conifer species, Sciadopitysin exhibits various biological activities predominantly through its interaction with cellular systems and pathways.</p>Formula:C33H24O10Purity:Min. 95%Color and Shape:PowderMolecular weight:580.54 g/mol







