
CAS 521-39-1
:Salazinic acid
Description:
Salazinic acid, with the CAS number 521-39-1, is a naturally occurring compound classified as a secondary metabolite. It is primarily found in certain species of lichens, particularly those in the genus *Lobaria*. This compound is characterized by its complex structure, which includes multiple functional groups that contribute to its biological activity. Salazinic acid exhibits properties such as antimicrobial and antioxidant activities, making it of interest in pharmacological research. It is typically a white to pale yellow crystalline solid, soluble in polar solvents like water and alcohol, but less soluble in non-polar solvents. The compound's molecular structure includes a phenolic group, which is responsible for some of its chemical reactivity. Salazinic acid is also studied for its potential applications in medicine and environmental science, particularly in understanding lichen symbiosis and its ecological roles. Overall, salazinic acid is a significant compound in both natural product chemistry and potential therapeutic applications.
Formula:C18H12O10
InChI:InChI=1S/C18H12O10/c1-5-2-8(21)6(3-19)13-9(5)16(23)27-14-7(4-20)12(22)10-11(15(14)26-13)18(25)28-17(10)24/h2-3,18,20-22,25H,4H2,1H3
InChI key:InChIKey=QQTKVXCQLZIJPP-UHFFFAOYSA-N
SMILES:OC1C=2C3=C(C(CO)=C(O)C2C(=O)O1)OC(=O)C=4C(O3)=C(C=O)C(O)=CC4C
Synonyms:- Salacinic acid
- 1,3-Dihydro-1,4,10-trihydroxy-5-(hydroxymethyl)-8-methyl-3,7-dioxo-7H-isobenzofuro[4,5-b][1,4]benzodioxepin-11-carboxaldehyde
- Salazinic acid
- Isophthalaldehydic acid, 2-[(3-carboxy-α2,α2,α3,4,6-pentahydroxy-2,5-xylyl)oxy]-4-hydroxy-6-methyl-, γ-lactone ε-lactone
- 7H-Isobenzofuro[4,5-b][1,4]benzodioxepin-11-carboxaldehyde, 1,3-dihydro-1,4,10-trihydroxy-5-(hydroxymethyl)-8-methyl-3,7-dioxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Salazinic Acid
CAS:Salazinic Acid is a compound extracted from the Lichen Hypotrachyna cirrhata with potential antioxidant activity.
Formula:C18H12O10Color and Shape:SolidMolecular weight:388.28Salazinic acid
CAS:Salazinic acid is a small molecule that has been shown to have pharmacological properties. Salazinic acid binds to the receptor site of ion channels and inhibits the activity of these channels. It also binds to peptide ligands, which are used in cell biology research as an inhibitor or activator of protein interactions. Salazinic acid is a high-purity reagent that can be used as a research tool for studying ion channels and antibody production.
Formula:C18H12O10Purity:Min. 95%Molecular weight:388.3 g/mol

