CAS 521-39-1: Salazinic acid

Description:Salazinic acid, with the CAS number 521-39-1, is a naturally occurring compound classified as a secondary metabolite. It is primarily found in certain species of lichens, particularly those in the genus *Lobaria*. This compound is characterized by its complex structure, which includes multiple functional groups that contribute to its biological activity. Salazinic acid exhibits properties such as antimicrobial and antioxidant activities, making it of interest in pharmacological research. It is typically a white to pale yellow crystalline solid, soluble in polar solvents like water and alcohol, but less soluble in non-polar solvents. The compound's molecular structure includes a phenolic group, which is responsible for some of its chemical reactivity. Salazinic acid is also studied for its potential applications in medicine and environmental science, particularly in understanding lichen symbiosis and its ecological roles. Overall, salazinic acid is a significant compound in both natural product chemistry and potential therapeutic applications.

Formula:C₁₈H₁₂O₁₀

InChI:InChI=1S/C18H12O10/c1-5-2-8(21)6(3-19)13-9(5)16(23)27-14-7(4-20)12(22)10-11(15(14)26-13)18(25)28-17(10)24/h2-3,18,20-22,25H,4H2,1H3

InChI key:InChIKey=QQTKVXCQLZIJPP-UHFFFAOYSA-N

SMILES:O=CC1=C(O)C=C(C=2C(=O)OC3=C(OC12)C4=C(C(=O)OC4O)C(O)=C3CO)C

Synonyms:
Salacinic acid
1,3-Dihydro-1,4,10-trihydroxy-5-(hydroxymethyl)-8-methyl-3,7-dioxo-7H-isobenzofuro[4,5-b][1,4]benzodioxepin-11-carboxaldehyde
Salazinic acid
Isophthalaldehydic acid, 2-[(3-carboxy-α2,α2,α3,4,6-pentahydroxy-2,5-xylyl)oxy]-4-hydroxy-6-methyl-, γ-lactone ε-lactone
7H-Isobenzofuro[4,5-b][1,4]benzodioxepin-11-carboxaldehyde, 1,3-dihydro-1,4,10-trihydroxy-5-(hydroxymethyl)-8-methyl-3,7-dioxo-