CAS 521-43-7

4,5,7,8-Tetramethoxyfuro[2,3-b]quinoline

Description:

4,5,7,8-Tetramethoxyfuro[2,3-b]quinoline is a synthetic organic compound characterized by its complex fused ring structure, which includes both a quinoline and a furan moiety. This compound features four methoxy groups (-OCH3) attached to the quinoline framework, which significantly influences its chemical properties, including solubility and reactivity. It is typically a yellow to orange crystalline solid, exhibiting moderate stability under standard conditions. The presence of methoxy groups enhances its electron-donating ability, which can affect its interaction with biological systems, potentially leading to various pharmacological activities. The compound is of interest in medicinal chemistry and may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects can vary based on structural modifications and environmental conditions. Its CAS number, 521-43-7, is a unique identifier that facilitates its recognition in chemical databases and literature. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₅H₁₅NO₅

InChI: InChI=1S/C15H15NO5/c1-17-9-7-10(18-2)14(20-4)12-11(9)13(19-3)8-5-6-21-15(8)16-12/h5-7H,1-4H3

InChI key: InChIKey=XTCGYRFLVLFRGW-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(OC)=C3C(=N2)OC=C3)=C(OC)C=C1OC

Synonyms:

• Acronycidine
• 5,7,8-Trimethoxydictamnine
• Furo[2,3-b]quinoline, 4,5,7,8-tetramethoxy-
• 4,5,7,8-Tetramethoxyfuro[2,3-b]quinoline
• NSC 30619

5,7,8-Trimethoxydictamnine

CAS: 521-43-7

5,7,8-Trimethoxydictamnine, a Rutaceae alkaloid, combats chloroquine-sensitive/-resistant P. falciparum (IC50s: 19.9, 5.72 μg/ml).

Formula: C₁₅H₁₅NO₅

Color and Shape: Solid

Molecular weight: 289.28

Ref: TM-T35484

5,7,8-Trimethoxydictamnine

CAS: 521-43-7

5,7,8-Trimethoxydictamnine is a natural alkaloid, which is extracted from certain plant species, notably within the Rutaceae family. This compound is characterized by its unique chemical structure, comprising three methoxy groups attached to its core, which may play a crucial role in its biological functions. Alkaloids of this nature are often the focus of pharmacological studies due to their complex interactions within biological systems.

Formula: C₁₅H₁₅NO₅

Purity: Min. 95%

Molecular weight: 289.28 g/mol

Ref: 3D-AAA52143