CymitQuimica logo

CAS 521-49-3

:

2,3-Dihydro-2,3,3-trimethylnaphtho[1,2-b]furan-4,5-dione

Description:
2,3-Dihydro-2,3,3-trimethylnaphtho[1,2-b]furan-4,5-dione, with the CAS number 521-49-3, is a polycyclic organic compound characterized by its complex fused ring structure. It features a naphthalene backbone with additional furan and diketone functionalities, contributing to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific structural isomers. It is known for its potential applications in organic synthesis and as a precursor in the development of various chemical products. The presence of multiple methyl groups enhances its hydrophobicity and may influence its reactivity and solubility in organic solvents. Additionally, the diketone functional groups can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,3-Dihydro-2,3,3-trimethylnaphtho[1,2-b]furan-4,5-dione is a compound of interest in both academic and industrial chemistry contexts.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-8-15(2,3)11-13(17)12(16)9-6-4-5-7-10(9)14(11)18-8/h4-8H,1-3H3
InChI key:InChIKey=WGENOABUKBFVAA-UHFFFAOYSA-N
SMILES:CC1(C)C2=C(C=3C(C(=O)C2=O)=CC=CC3)OC1C
Synonyms:
  • SL 11010
  • (±)-Dunnione
  • 2,3-Dihydro-2,3,3-trimethylnaphtho[1,2-b]furan-4,5-dione
  • Naphtho[1,2-b]furan-4,5-dione, 2,3-dihydro-2,3,3-trimethyl-
  • NSC 95403
Found 2 products.