CAS 521-51-7
:(2E)-1-(2,5-dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(2,5-dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one, with the CAS number 521-51-7, is a type of chalcone, which is characterized by its structure featuring a phenylpropene moiety. Chalcones are known for their yellow pigmentation and are often involved in various biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. This particular compound contains multiple methoxy and hydroxy groups, which can enhance its reactivity and solubility in organic solvents. The presence of these functional groups may also contribute to its potential pharmacological effects. The compound typically exhibits a conjugated double bond system, which can influence its electronic properties and stability. Additionally, due to its structural features, it may participate in various chemical reactions, such as Michael additions or cyclization, making it of interest in synthetic organic chemistry and medicinal chemistry research. Overall, this compound exemplifies the diverse chemistry and potential applications of chalcones in various fields.
Formula:C18H18O6
InChI:InChI=1/C18H18O6/c1-22-16-13(12(19)10-9-11-7-5-4-6-8-11)14(20)17(23-2)18(24-3)15(16)21/h4-10,20-21H,1-3H3/b10-9+
Synonyms:- (2E)-1-(2,5-Dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-1-(2,5-Dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one
CAS:Formula:C18H18O6Molecular weight:330.3319Pedicin
CAS:Pedicin is a natural product for research related to life sciences. The catalog number is TN4746 and the CAS number is 521-51-7.Formula:C18H18O6Purity:98%Color and Shape:SolidMolecular weight:330.333',6'-Dihydroxy-2',4',5'-trimethoxychalcone
CAS:<p>3',6'-Dihydroxy-2',4',5'-trimethoxychalcone is a chalcone derivative, which is a type of flavonoid commonly studied in the context of natural product chemistry and pharmacology. This compound is primarily sourced from plants, known for their diverse array of bioactive secondary metabolites. Chalcones, including this derivative, have been isolated from various botanical species, particularly those used in traditional medicine.</p>Formula:C18H18O6Purity:Min. 95%Color and Shape:PowderMolecular weight:330.33 g/mol3',6'-Dihydroxy-2',4',5'-trimethoxychalcone
CAS:Controlled ProductFormula:C18H18O6Color and Shape:NeatMolecular weight:330.33




