CAS 521-52-8
:Vulpinic acid
Description:
Vulpinic acid is a naturally occurring compound classified as a lichenic acid, primarily found in certain species of lichens, particularly those in the genus Vulpicida. It is characterized by its chemical structure, which includes a bicyclic system with a carboxylic acid functional group. Vulpinic acid is known for its yellowish color and is often used as a pigment in various applications. The compound exhibits antimicrobial properties, making it of interest in pharmacological research. Additionally, it has been studied for its potential antioxidant activity. Vulpinic acid is soluble in organic solvents but has limited solubility in water, which is typical for many organic acids. Its molecular formula reflects its complex structure, and it is often analyzed using techniques such as chromatography and spectroscopy to determine its purity and concentration in various samples. Overall, vulpinic acid is a compound of interest in both natural product chemistry and potential therapeutic applications.
Formula:C19H14O5
InChI:InChI=1S/C19H14O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,20H,1H3/b17-15+
InChI key:InChIKey=OMZRMXULWNMRAE-BMRADRMJSA-N
SMILES:C(\C(OC)=O)(=C/1\C(O)=C(C(=O)O1)C2=CC=CC=C2)/C3=CC=CC=C3
Synonyms:- Benzeneacetic acid, α-(3-hydroxy-5-oxo-4-phenyl-2(5H)-furanylidene)-, methyl ester, (E)-
- Benzeneacetic acid, α-(3-hydroxy-5-oxo-4-phenyl-2(5H)-furanylidene)-, methyl ester, (αE)-
- NSC 5897
- Vulpinic Acid
- methyl (2E)-(3-hydroxy-5-oxo-4-phenylfuran-2(5H)-ylidene)(phenyl)ethanoate
- methyl (2Z)-(3,5-dioxo-4-phenyldihydrofuran-2(3H)-ylidene)(phenyl)ethanoate
- methyl (2Z)-(5-hydroxy-3-oxo-4-phenylfuran-2(3H)-ylidene)(phenyl)ethanoate
- Δ<sup>2(5</sup><sup>H</sup><sup>),α</sup>-Furanacetic acid, 3-hydroxy-5-oxo-α,4-diphenyl-, methyl ester
- Δ2(5H),α-Furanacetic acid, 3-hydroxy-5-oxo-α,4-diphenyl-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Vulpic acid
CAS:Vulpic acid analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C19H14O5Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:322.32Vulpinic Acid
CAS:Vulpinic Acid (Pulvinic acid methyl ester) is a lichen metabolite with anti-inflammatory, antibacteria, properties, plant growth inhibitor.Formula:C19H14O5Purity:99.69%Color and Shape:SolidMolecular weight:322.31Vulpinic Acid
CAS:Controlled ProductApplications A lichen metabolite with anti-inflammatory properties.
References Shachak, M., et al.: Science, 236, 1098 (1987), Froberg, L., et al.: Lichenologist, 25, 83 (1993), Hesbacher, S., et al.: J. Chem. Ecology, 21, 233 (1995),Formula:C19H14O5Color and Shape:NeatMolecular weight:322.31Vulpinic acid
CAS:Vulpinic acid is a lichen-derived compound that belongs to the group of polycyclic aromatic hydrocarbons. It has been shown to have antiviral, anti-inflammatory and immunosuppressive effects in vitro. Vulpinic acid may be a potential drug target for autoimmune diseases and skin cells.Formula:C19H14O5Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:322.31 g/mol




