CAS 52107-87-6

4-Iodo-3-methylbenzoic acid

Description:

4-Iodo-3-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a methyl group on a benzoic acid framework. The molecular structure features a benzene ring with a carboxylic acid (-COOH) group at one position and an iodine atom at the para position relative to the carboxylic acid, while a methyl group is located at the meta position. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits typical acid properties, including the ability to donate protons in solution. The presence of the iodine atom can influence its reactivity and stability, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique physical and chemical properties, such as altered melting and boiling points compared to its non-iodinated counterparts, due to the effects of halogen substitution on the molecular interactions.

Formula: C₈H₇IO₂

InChI: InChI=1/C8H7IO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)

SMILES: Cc1cc(ccc1I)C(=O)O

4-Iodo-3-methylbenzoic acid

CAS: 52107-87-6

Formula: C₈H₇IO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.0444

Ref: IN-DA00D8QL

4-Iodo-3-methylbenzoic acid

CAS: 52107-87-6

4-Iodo-3-methylbenzoic acid

Purity: 98%

Molecular weight: 262.04445g/mol

Ref: 54-OR304205

Suvorexant Impurity 32

CAS: 52107-87-6

Formula: C₈H₇IO₂

Molecular weight: 262.05

Ref: 4Z-S-120036

4-Iodo-3-methylbenzoic acid

CAS: 52107-87-6

4-Iodo-3-methylbenzoic acid is a bifunctional phosphine that can be activated by phosphine gas. This compound has been shown to react with diethyl ethers and form a lanthanide phosphine complex. 4-Iodo-3-methylbenzoic acid also reacts with azides to form triazinylphosphines, which are used in fluorescence techniques. 4-Iodo-3-methylbenzoic acid has luminescent properties, which may be due to its ability to produce singlet oxygen when irradiated with visible light.

Formula: C₈H₇IO₂

Purity: Min. 80%

Color and Shape: Powder

Molecular weight: 262.04 g/mol

Ref: 3D-FI70206

4-Iodo-3-methylbenzoic acid

CAS: 52107-87-6

Formula: C₈H₇IO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.046

Ref: 10-F018745