CAS 52109-66-7
:5-phenylpyrazine-2,3-dicarbonitrile
Description:
5-Phenylpyrazine-2,3-dicarbonitrile is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of two cyano groups (-C≡N) at the 2 and 3 positions of the pyrazine ring contributes to its reactivity and potential applications in organic synthesis and materials science. The phenyl group attached to the 5-position enhances its aromatic character and may influence its electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its chemical properties include the ability to undergo nucleophilic addition reactions due to the electron-withdrawing nature of the cyano groups, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with cyano groups can be toxic and require appropriate precautions.
Formula:C12H6N4
InChI:InChI=1/C12H6N4/c13-6-10-11(7-14)16-12(8-15-10)9-4-2-1-3-5-9/h1-5,8H
SMILES:c1ccc(cc1)c1cnc(C#N)c(C#N)n1
Synonyms:- 2,3-Dicyano-5-phenylpyrazine
- 2,3-Pyrazinedicarbonitrile, 5-Phenyl-
- 5-Phenylpyrazine-2,3-dicarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
