CAS 5211-01-8
:3-Chloro-4-(methylthio)benzenamine
Description:
3-Chloro-4-(methylthio)benzenamine, with the CAS number 5211-01-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a methylthio group. This compound features an amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the chlorine atom enhances its electrophilic properties, making it useful in nucleophilic substitution reactions. The methylthio group, consisting of a sulfur atom bonded to a methyl group, can influence the compound's solubility and reactivity, often enhancing its biological activity. 3-Chloro-4-(methylthio)benzenamine is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. It is often utilized in the synthesis of dyes, pharmaceuticals, and agrochemicals, reflecting its importance in industrial applications. As with many amines, it may also participate in hydrogen bonding, affecting its physical properties such as boiling and melting points.
Formula:C7H8ClNS
InChI:InChI=1S/C7H8ClNS/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,9H2,1H3
InChI key:InChIKey=AIUFATMGALKMOI-UHFFFAOYSA-N
SMILES:S(C)C1=C(Cl)C=C(N)C=C1
Synonyms:- Benzenamine, 3-chloro-4-(methylthio)-
- 3-Chloro-4-(methylthio)aniline
- 3-Chloro-4-(methylthio)benzenamine
- Aniline, 3-chloro-4-(methylthio)-
- 4-Amino-2-chlorothioanisole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
