CAS 5211-44-9: 2,3,5,6-tetrafluoro-4-sulfanylbenzoic acid

Description:2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid, with the CAS number 5211-44-9, is a fluorinated aromatic compound characterized by the presence of four fluorine atoms and a thiol (-SH) group attached to a benzoic acid structure. This compound exhibits significant polarity due to the electronegative fluorine atoms, which can influence its solubility and reactivity. The presence of the sulfanyl group introduces unique chemical properties, making it a potential candidate for various applications in organic synthesis and materials science. Its fluorinated nature may enhance stability and alter the compound's interaction with biological systems, potentially affecting its pharmacological properties. Additionally, the carboxylic acid functional group allows for acid-base reactions and can participate in hydrogen bonding, influencing its behavior in different solvents. Overall, 2,3,5,6-tetrafluoro-4-sulfanylbenzoic acid is a versatile compound with interesting chemical characteristics that warrant further investigation for its potential applications in various fields.

Formula:C₇H₂F₄O₂S

InChI:InChI=1/C7H2F4O2S/c8-2-1(7(12)13)3(9)5(11)6(14)4(2)10/h14H,(H,12,13)

Synonyms:
Benzoic Acid, 2,3,5,6-Tetrafluoro-4-Mercapto-
2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,3,5,6-Tetrafluoro-4-mercaptobenzoic Acid REF: 3B-T2542CAS: 5211-44-9	>98.0%(GC)(T)	69.00 €~198.00 €	Fri 25 Apr 25
2,3,5,6-tetrafluoro-4-mercapto-Benzoic acid REF: IN-DA003FEMCAS: 5211-44-9	98%	70.00 €~682.00 €	Fri 02 May 25
2,3,5,6-Tetrafluoro-4-mercapto-benzoic acid REF: 10-F691162CAS: 5211-44-9	98%	To inquire	Mon 12 May 25
2,3,5,6-Tetrafluoro-4-Mercapto-Benzoic Acid REF: 3D-FT87565CAS: 5211-44-9	Min. 95%	- - -	Discontinued product