CAS 52112-66-0

-;6-Bromo-1,3-benzoxazol-2-amine

Description:

6-Bromo-1,3-benzoxazol-2-amine is an organic compound characterized by its heterocyclic structure, which includes a benzoxazole ring fused with an amine group. The presence of the bromine atom at the 6-position of the benzoxazole ring contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amine functional group. It is often used in medicinal chemistry and material science, particularly in the development of pharmaceuticals and agrochemicals, owing to its biological activity and ability to interact with biological targets. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Bromo-1,3-benzoxazol-2-amine is a valuable compound in research and industrial applications, with ongoing studies exploring its full potential.

Formula: C₇H₄BrNO

InChI: InChI=1/C7H4BrNO/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H

SMILES: c1cc2c(cc1Br)ocn2

Synonyms:

• 2-Benzoxazolamine, 6-Bromo-

2-Amino-6-bromobenzoxazole

CAS: 52112-66-0

Formula: C₇H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.0314

Ref: IN-DA003GI0

2-Amino-6-bromobenzoxazole

CAS: 52112-66-0

2-Amino-6-bromobenzoxazole

Purity: 96%

Molecular weight: 213.03g/mol

Ref: 54-OR1010285

2-Amino-6-bromobenzoxazole

CAS: 52112-66-0

Formula: C₇H₅BrN₂O

Purity: 95%

Color and Shape: Solid, Red powder

Molecular weight: 213.034

Ref: 10-F230703