CymitQuimica logo

CAS 521266-92-2

:

4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole

Description:
4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a methyl group and a 3-methylphenyl substituent contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The oxazole moiety is known for its applications in pharmaceuticals and agrochemicals, often exhibiting biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 521266-92-2, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound exemplifies the diverse functionalities that can arise from heterocyclic chemistry, making it a subject of interest in various fields of research.
Formula:C12H12ClNO
InChI:InChI=1/C12H12ClNO/c1-8-4-3-5-10(6-8)12-14-11(7-13)9(2)15-12/h3-6H,7H2,1-2H3
InChI key:CZFJTOSWONKWDN-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)c1nc(CCl)c(C)o1
Found 1 products.