CAS 52127-83-0: 4-(2,6-Dichloropyrimidin-4-yl)-morpholine
Description:4-(2,6-Dichloropyrimidin-4-yl)-morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a dichloropyrimidine moiety. The presence of the dichloropyrimidine group imparts specific electronic and steric properties, making it of interest in various chemical applications, particularly in medicinal chemistry and agrochemicals. This compound typically exhibits moderate to high solubility in polar organic solvents, which is influenced by the morpholine's basicity and the electron-withdrawing nature of the dichloropyrimidine. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound may exhibit specific reactivity patterns due to the presence of halogen atoms, which can participate in nucleophilic substitution reactions. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 4-(2,6-Dichloropyrimidin-4-yl)-morpholine is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H9Cl2N3O
InChI:InChI=1S/C8H9Cl2N3O/c9-6-5-7(12-8(10)11-6)13-1-3-14-4-2-13/h5H,1-4H2
InChI key:InChIKey=QGGYMWHOBGSQCF-UHFFFAOYSA-N
SMILES:ClC=1N=C(Cl)C=C(N1)N2CCOCC2
- Synonyms:
- 2,4-Dichloro-6-(morpholin-4-yl)pyrimidine
- 2,4-Dichloro-6-morpholinopyrimidine
- 4-(2,6-Dichloro-4-pyrimidinyl)morpholine
- 6-Morpholino-2,4-dichloropyrimidine
- Morpholine, 4-(2,6-Dichloro-4-Pyrimidinyl)-
- 4-(2,6-Dichloropyrimidin-4-yl)morpholine
- 4-(2,6-Dichloropyrimidin-4-yl)-morpholine

4-(2,6-Dichloro-4-pyrimidyl)morpholine
Ref: 3B-D4571
1g | 93.00 € | ||
5g | 307.00 € |

4-(2,6-dichloropyrimidin-4-yl)morpholine
Ref: IN-DA00DF94
1g | 111.00 € | ||
5g | 228.00 € | ||
250mg | 60.00 € |

Ref: 54-OR471279
1g | 86.00 € | ||
5g | 271.00 € | ||
25g | 1,141.00 € | ||
100mg | 36.00 € | ||
250mg | 43.00 € |

4-(2,6-Dichloropyrimidin-4-yl)morpholine
Ref: 10-F226189
1g | 69.00 € | ||
5g | 255.00 € | ||
10g | 471.00 € |

4-(2,6-Dichloropyrimidin-4-yl)-morpholine
Controlled ProductRef: TR-D436020
250mg | 307.00 € | ||
2500mg | 2,102.00 € |

4-(2,6-Dichloropyrimidin-4-yl)-morpholine
Ref: 3D-CCA12783
2500mg | 448.00 € |