CAS 521284-19-5
:(R)-N-(4-nitrophenethyl)-2-hydroxy-2-phenylacetamide
Description:
(R)-N-(4-nitrophenethyl)-2-hydroxy-2-phenylacetamide, with the CAS number 521284-19-5, is a chiral compound characterized by its specific stereochemistry, which is indicated by the (R) configuration. This substance features a phenylacetamide backbone, which is modified by the presence of a 4-nitrophenethyl group and a hydroxyl group at the second carbon of the acetamide. The presence of the nitro group contributes to its electronic properties, potentially influencing its reactivity and interactions with biological targets. The hydroxyl group enhances its solubility in polar solvents and may participate in hydrogen bonding, affecting its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its chirality suggests that it may have different biological effects compared to its enantiomer, which is crucial in the context of drug efficacy and safety. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C16H16N2O4
InChI:InChI=1S/C16H16N2O4/c19-15(13-4-2-1-3-5-13)16(20)17-11-10-12-6-8-14(9-7-12)18(21)22/h1-9,15,19H,10-11H2,(H,17,20)/t15-/m1/s1
SMILES:c1ccc(cc1)[C@H](C(=NCCc1ccc(cc1)N(=O)=O)O)O
Synonyms:- (2R)-2-Hydroxy-N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide
- Mirabegron Intermediate 1
- (alphaR)-alpha-Hydroxy-N-[2-(4-nitrophenyl)ethyl]benzeneacetamide
- (R)-2-hydroxy-N-(4-nitrophenethyl)-2-phenylacetamide
- R-2-((4-aminophenethyl)amino)-1-phenylethan-1-ol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(R)-N-(4-nitrophenethyl)-2-hydroxy-2-phenylacetamide
CAS:Formula:C16H16N2O4Purity:97%Color and Shape:SolidMolecular weight:300.3092(R)-2-Hydroxy-N-(4-nitrophenethyl)-2-phenylacetamide
CAS:(R)-2-Hydroxy-N-(4-nitrophenethyl)-2-phenylacetamidePurity:97%(2R)-2-Hydroxy-N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide
CAS:Formula:C16H16N2O4Color and Shape:NeatMolecular weight:300.31(R)-2-Hydroxy-N-(4-nitrophenethyl)-2-phenylacetamide
CAS:Formula:C16H16N2O4Purity:97%Color and Shape:No data available.Molecular weight:300.314(aR)-a-Hydroxy-N-[2-(4-nitrophenyl)ethyl]benzeneacetamide
CAS:(aR)-A-hydroxy-N-[2-(4-nitrophenyl)ethyl]benzeneacetamide is a solvent that is used in the production of other chemicals. It is a high yield reductive amination process that has been scaled up to produce ammonium salt solvents. The reduction process involves the use of aluminium as a reducing agent and ammonia as an additive, which helps to increase the yield. This chemical can be produced using a variety of reactors, such as autoclaves, tanks, and stirred tank reactors. (aR)-A-hydroxynaphthaleneacetamide can also be produced using mirabegron as a synthetic pathway.Formula:C16H16N2O4Purity:Min. 95%Molecular weight:300.31 g/mol






