CAS 52130-87-7
:2-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide
Description:
2-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a chlorobenzoyl moiety. This compound features an acetamide functional group, which contributes to its solubility in polar solvents. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in organic synthesis. The chlorobenzoyl group enhances the compound's lipophilicity, making it potentially useful in medicinal chemistry and as a building block in the synthesis of more complex molecules. Additionally, the bromine atom can serve as a site for further chemical modifications, allowing for the development of derivatives with varied biological activities. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling precautions should be observed due to the presence of halogens and nitro groups, which can pose health and environmental risks.
Formula:C15H10BrClN2O4
InChI:InChI=1S/C15H10BrClN2O4/c16-8-14(20)18-13-6-5-9(19(22)23)7-11(13)15(21)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,18,20)
InChI key:InChIKey=XSTMFEOLMKEEMU-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC(CBr)=O)C=CC(N(=O)=O)=C1)C2=C(Cl)C=CC=C2
Synonyms:- 2-(2-Bromoacetamido)-5-Nitro-2'-Chlorobenzophenone
- Acetamide, 2-bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]-
- 2-Bromo-N-(2-(2-chlorobenzoyl)-4-nitrophenyl)acetamide
- 2-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Clonazepam Related Compound C (2-bromo-2'-(2-chlorobenzoyl)-4'-nitroacetanilide)
CAS:Aromatic cyclic amides (including cyclic carbamates) and their derivatives; salts thereofFormula:C15H10BrClN2O4Color and Shape:White PowderMolecular weight:395.951252-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide
CAS:Formula:C15H10BrClN2O4Purity:98%Color and Shape:SolidMolecular weight:397.60792-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide
CAS:2-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamidePurity:98%Molecular weight:397.61g/mol2-Bromo-2'-(2-chlorobenzoyl)-4'-nitroacetanilide
CAS:Controlled ProductFormula:C15H10BrClN2O4Color and Shape:Light YellowMolecular weight:397.612-Bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide(Clonazepam Impurity)
CAS:Controlled ProductApplications An impurity from the synthesis of clonazepam (C587080)
Formula:C15H10BrClN2O4Color and Shape:Light YellowMolecular weight:397.612-Bromo-N-(2-(2-chlorobenzoyl)-4-nitrophenyl)acetamide
CAS:Formula:C15H10BrClN2O4Purity:98%Molecular weight:397.61Clonazepam Related Compound C
CAS:Please enquire for more information about Clonazepam Related Compound C including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C15H10BrClN2O4Purity:Min. 95%Molecular weight:397.61 g/mol








