CAS 5216-30-8
:4-tert-butyl-1-[(2,2-dichlorocyclopropyl)methyl]-2-nitrobenzene
Description:
4-tert-butyl-1-[(2,2-dichlorocyclopropyl)methyl]-2-nitrobenzene, with CAS number 5216-30-8, is an organic compound characterized by its complex structure, which includes a nitro group, a tert-butyl group, and a dichlorocyclopropyl moiety. This compound typically exhibits properties common to nitro-substituted aromatic compounds, such as being a solid at room temperature and having a relatively high melting point. Its molecular structure suggests it may possess significant lipophilicity due to the presence of the bulky tert-butyl group, which can influence its solubility in organic solvents. The dichlorocyclopropyl group may impart unique reactivity and stability characteristics, potentially making it useful in various chemical applications, including as an intermediate in organic synthesis. Additionally, the nitro group can participate in electrophilic aromatic substitution reactions, enhancing its utility in synthetic chemistry. Safety and handling precautions are essential, as compounds with nitro groups can be hazardous and may require specific storage conditions to prevent degradation or unwanted reactions.
Formula:C14H17Cl2NO2
InChI:InChI=1/C14H17Cl2NO2/c1-13(2,3)10-5-4-9(12(7-10)17(18)19)6-11-8-14(11,15)16/h4-5,7,11H,6,8H2,1-3H3
SMILES:CC(C)(C)c1ccc(CC2CC2(Cl)Cl)c(c1)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3,3'-Dichlorodiphenylacetylene
CAS:3,3'-Dichlorodiphenylacetylene is a versatile building block that is used in the synthesis of complex compounds. It has been used as a reagent and as a speciality chemical for research purposes. This chemical can be used as a useful building block for the synthesis of other compounds, or it can be reacted with other compounds to form new compounds. 3,3'-Dichlorodiphenylacetylene is also an intermediate in organic syntheses and has been shown to react with many different types of molecules.
Formula:C14H8Cl2Purity:Min. 95%Color and Shape:PowderMolecular weight:247.12 g/mol
