CAS 52162-05-7
:S-phenylhomocysteine
Description:
S-phenylhomocysteine, with the CAS number 52162-05-7, is an amino acid derivative that is structurally related to homocysteine, featuring a phenyl group attached to the sulfur atom. This compound is characterized by its chiral center, which contributes to its potential biological activity. S-phenylhomocysteine is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, which facilitates its use in various biochemical applications. The presence of the phenyl group may influence its interaction with biological molecules, potentially affecting its role in metabolic pathways. This compound is of interest in research related to amino acid metabolism and may have implications in studies of cardiovascular health, given the association of homocysteine levels with various health conditions. As with many amino acid derivatives, S-phenylhomocysteine can participate in various chemical reactions, making it a valuable compound in synthetic organic chemistry and pharmaceutical research.
Formula:C10H13NO2S
InChI:InChI=1/C10H13NO2S/c11-9(10(12)13)6-7-14-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)
SMILES:c1ccc(cc1)SCCC(C(=O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Amino-4-(phenylsulfanyl)butanoic acid
CAS:2-Amino-4-(phenylsulfanyl)butanoic acid (NPA) is an inhibitor of the enzyme s-adenosyl-l-methionine synthase, which is involved in the synthesis of methyl groups from methionine. It has been shown to inhibit the growth of viruses such as herpes simplex virus type 1 and 2. NPA has also been shown to inhibit the growth of bacteria such as Mycobacterium tuberculosis and Mycobacterium avium complex by inhibiting the production of mycolic acids, which are essential for cell wall synthesis. NPA also inhibits conformational changes in enzymes, which may be related to its ability to inhibit the growth of bacteria that require a linear transition state for catalysis.Formula:C10H13NO2SPurity:Min. 95%Molecular weight:211.28 g/mol
