CAS 52169-89-8
:4-METHYL-2-PHENYL-1,3-OXAZOLE-5-CARBONYL CHLORIDE
Description:
4-Methyl-2-phenyl-1,3-oxazole-5-carbonyl chloride, with the CAS number 52169-89-8, is a chemical compound characterized by its oxazole ring structure, which features a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methyl and phenyl substituents contribute to its hydrophobic character and may influence its solubility in organic solvents. The oxazole moiety can also impart specific electronic properties, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use and the presence of other functional groups in related compounds. Safety precautions should be taken when handling this substance, as carbonyl chlorides can be hazardous.
Formula:C11H8ClNO2
InChI:InChI=1/C11H8ClNO2/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3
SMILES:Cc1c(C(=O)Cl)oc(c2ccccc2)n1
Synonyms:- 5-Chlorocarbonyl-4-methyl-2-phenyl-1,3-oxazole
- 4-METHYL-2-PHENYL-1,3-OXAZOLE-5-CARBONYL CHLORIDE
- 4-Methyl-2-phenyl-1,3-oxazole-5-carbonylchloride97%
- 4-Methyl-2-phenyl-1,3-oxazole-5-carbonyl chloride 97%
- 5-Oxazolecarbonyl chloride, 4-methyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.