CAS 5217-05-0

1-Methylcyclopentanecarboxylic acid

Description:

1-Methylcyclopentanecarboxylic acid is a cyclic carboxylic acid characterized by a cyclopentane ring with a methyl group and a carboxylic acid functional group attached. Its molecular structure features a five-membered carbon ring, which contributes to its unique physical and chemical properties. This compound typically appears as a colorless to pale yellow liquid and has a moderate boiling point, indicative of its molecular weight and structure. It is soluble in organic solvents, reflecting its hydrophobic nature, while exhibiting limited solubility in water due to the presence of the bulky cyclopentane ring. The carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. Additionally, 1-methylcyclopentanecarboxylic acid can serve as an intermediate in organic synthesis and may have applications in the production of fragrances or pharmaceuticals. Its safety profile should be considered, as with any chemical substance, and appropriate handling procedures should be followed to mitigate any potential hazards.

Formula: C₇H₁₂O₂

InChI: InChI=1S/C7H12O2/c1-7(6(8)9)4-2-3-5-7/h2-5H2,1H3,(H,8,9)

InChI key: InChIKey=MNIBBVOEXUQHFF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C)CCCC1

Synonyms:

• 1-Methylcyclopentane-1-carboxylic acid
• 1-Methylcyclopentanoic acid
• 1-Methylcyclopentanecarboxylic acid
• Cyclopentanecarboxylic acid, 1-methyl-

Cyclopentanecarboxylic acid, 1-methyl-

CAS: 5217-05-0

Formula: C₇H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 128.1690

Ref: IN-DA00DBKH

1-Methylcyclopentane-1-carboxylic acid

CAS: 5217-05-0

1-Methylcyclopentane-1-carboxylic acid

Purity: 95%

Molecular weight: 128.17g/mol

Ref: 54-OR86742

1-methylcyclopentanecarboxylic acid

CAS: 5217-05-0

Formula: C₇H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 128.171

Ref: 10-F312950