CAS 52175-10-7
:1H-Purin-6-amine, phosphate (1:?)
Description:
1H-Purin-6-amine, phosphate (1:?) is a chemical compound that serves as a derivative of purine, a fundamental building block of nucleic acids. This substance is characterized by its purine base structure, which includes a fused double-ring system composed of carbon and nitrogen atoms. The presence of an amine group at the 6-position of the purine ring contributes to its reactivity and biological significance. The phosphate group attached to the molecule plays a crucial role in energy transfer and storage, as well as in the formation of nucleotides, which are essential for DNA and RNA synthesis. This compound is often involved in various biochemical pathways, including those related to cellular signaling and metabolism. Its solubility in water and stability under physiological conditions make it relevant for research in biochemistry and molecular biology. Overall, 1H-Purin-6-amine, phosphate is significant in the context of nucleic acid chemistry and cellular function.
Formula:C5H8N5O4P
InChI:InChI=1/C5H5N5.H3O4P/c6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h1-2H,(H3,6,7,8,9,10);(H3,1,2,3,4)
InChI key:InChIKey=CCHNOBQMQBSRHQ-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.NC1=C2C(=NC=N1)N=CN2
Synonyms:- 1H-Purin-6-amine, phosphate
- 1H-Purin-6-amine, phosphate (1:?)
- 7H-purin-6-amine phosphate (1:1)
- Adenine Purine phosphate
- Adenine phosphate
- 6-AMINOPURINE PHOSPHATE
- Vitamin B4
- Vitamine B4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Purin-6-amine, phosphate
CAS:Formula:C5H8N5O4PPurity:98%Color and Shape:SolidMolecular weight:233.1219Adenine phosphate
CAS:Controlled Product<p>Adenine phosphate is a molecule that acts as a regulator of endogenous adenosine. It has been shown to inhibit the growth of skin cells in tissue culture and to be effective against influenza virus and other viruses when used in combination with pyridoxine hydrochloride. The molecular weight of adenine phosphate is 314.2 g/mol, corresponding to two nitrogen atoms and four phosphorus atoms. Adenine phosphate is an oxidized form of adenosine triphosphate (ATP) with one phosphate group removed from the molecule. This irreversible oxidation occurs when ATP is exposed to the environment, for example, during tissue culture or viral infection. The effective dose for treating cancer has not yet been determined; however, doses of up to 5 mg/kg are not toxic to mice.</p>Formula:C5H5N5•H3PO4Purity:Min. 95%Color and Shape:SolidMolecular weight:233.12 g/mol



