CAS 52184-13-1
:2-(1,1-Dimethylethyl)-4-(1-methylpropyl)phenol
Description:
2-(1,1-Dimethylethyl)-4-(1-methylpropyl)phenol, commonly known as a type of alkylphenol, is an organic compound characterized by its phenolic structure with two branched alkyl groups. This compound features a tert-butyl group (1,1-dimethylethyl) and an isobutyl group (1-methylpropyl) attached to the aromatic ring, which contributes to its hydrophobic properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the hydroxyl (-OH) group imparts some polar characteristics, allowing for potential interactions with other polar substances. This compound is often used in various industrial applications, including as an antioxidant in plastics and rubber, due to its ability to inhibit oxidative degradation. Additionally, it may have applications in the formulation of lubricants and coatings. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C14H22O
InChI:InChI=1S/C14H22O/c1-6-10(2)11-7-8-13(15)12(9-11)14(3,4)5/h7-10,15H,6H2,1-5H3
InChI key:InChIKey=YHMYLDCYUHBSNP-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(C(CC)C)=CC=C1O
Synonyms:- 2-(1,1-Dimethylethyl)-4-(1-methylpropyl)phenol
- 2-tert-Butyl-4-sec-butylphenol
- 4-sec-Butyl-2-tert-butylphenol
- Phenol, 2-(1,1-Dimethylethyl)-4-(1-Methylpropyl)-
- Phenol, 4-sec-butyl-2-tert-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
